Predicted protein targets (top 18)
| gene | UniProt | supporting neighbours | confidence | |
|---|---|---|---|---|
| ▸ | TP53 | P04637 | 3/20 | 0.36 |
| ▸ | SIGMAR1 | Q99720 | 1/20 | 0.36 |
| ▸ | TDP1 | Q9NUW8 | 2/20 | 0.36 |
| ▸ | CYP3A4 | P08684 | 1/20 | 0.36 |
| ▸ | ESR1 | P03372 | 2/20 | 0.35 |
| ▸ | ESR2 | Q92731 | 2/20 | 0.35 |
| ▸ | DRD3 | P35462 | 2/20 | 0.35 |
| ▸ | RAB9A | P51151 | 1/20 | 0.34 |
| ▸ | HTR1A | P08908 | 1/20 | 0.33 |
| ▸ | MEN1 | O00255 | 1/20 | 0.33 |
| ▸ | TSHR | P16473 | 1/20 | 0.33 |
| ▸ | KMT2A | Q03164 | 1/20 | 0.33 |
| ▸ | SMN1; SMN2 | Q16637 | 1/20 | 0.33 |
| ▸ | NPSR1 | Q6W5P4 | 1/20 | 0.33 |
| ▸ | DRD2 | P14416 | 1/20 | 0.33 |
| ▸ | OPRM1 | P35372 | 1/20 | 0.33 |
| ▸ | OPRD1 | P41143 | 1/20 | 0.33 |
| ▸ | OPRK1 | P41145 | 1/20 | 0.33 |
Click a target to see other patent compounds predicted against it — the reverse direction, in place.
Similar compounds — the chemically nearest patent molecules
Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.
| Compound | similarity | top predicted | shared targets | |
|---|---|---|---|---|
| SCHEMBL17598759 | 0.87 | TDP1 (0.43) | SIGMAR1TDP1ESR1DRD3HTR1A | |
| SCHEMBL19530997 | 0.85 | CYP3A4 (0.43) | TDP1CYP3A4ESR1ESR2 | |
| SCHEMBL28823017 | 0.84 | KCNH2 (0.46) | SIGMAR1TDP1DRD3RAB9ADRD2 | |
| SCHEMBL10314926 | 0.84 | KCNH2 (0.46) | SIGMAR1TDP1DRD3RAB9ADRD2 | |
| SCHEMBL9864179 | 0.81 | CYP3A4 (0.39) | TP53SIGMAR1TDP1CYP3A4ESR1 | |
| SCHEMBL17190352 | 0.81 | SIGMAR1 (0.43) | SIGMAR1CYP3A4DRD3HTR1AMEN1 | |
| SCHEMBL15198850 | 0.80 | SIGMAR1 (0.39) | TP53SIGMAR1TDP1CYP3A4DRD3 | |
| SCHEMBL17190349 | 0.80 | TAAR1 (0.45) | SIGMAR1DRD3MEN1TSHRKMT2A | |
| SCHEMBL11292500 | 0.79 | CARM1 (0.42) | TDP1CYP3A4SMN1; SMN2 | |
| SCHEMBL17930135 | 0.78 | SIGMAR1 (0.49) | SIGMAR1CYP3A4DRD3HTR1ASMN1; SMN2 |
Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.
Patent provenance — the patents this molecule appears in, and who filed them
Claimed or disclosed in 3 patents. claimed = in the patent's claims; disclosed = body only.
| Patent | Title | Assignee | Published | Priority | Filing | Country | Status |
|---|---|---|---|---|---|---|---|
| US-20110257352-A1 | Amino phosphine | NOVA Chemicals (International) S.A.. | 2011-10-20 | — | — | US | disclosed |
| US-7994363-B2 | Bis(bis(o-fluorophenyl)phosphino) isopropylamine; ethylene oligomerization catalyst; trimerization and tetramerization to 1-hexene and 1-octene also in the presence of a chromium source and a methalumoxane activator; further copolymerization, or separating 1-hexene by distillation; by-product inhibition | NOVA CHEMICALS (INTERNATIONAL) S.A (CH) | 2011-08-09 | — | — | US | disclosed |
| US-20080242811-A1 | Amino phosphine | NOVA CHEMICALS(INTERNATIONAL) S.A. | 2008-10-02 | — | — | US | disclosed |
Patent text — is the patent's own abstract consistent with the prediction?
For each of this compound's patents that has machine-readable text (1 of them — usually the abstract, not the full specification), we ask MedCPT which protein the text reads most about, and where the chemistry-predicted target lands among 4885 human targets. A high rank means the patent's own wording is consistent with the prediction — a weak, independent signal, not proof of activity.
| Patent | Title | Text reads most about | Predicted target · text-rank |
|---|---|---|---|
| US-20080242811-A1 | Amino phosphine | PAM, POF1B, PHOSPHO1 | TP53 903/4885SIGMAR1 417/4885TDP1 1715/4885 |
“Text reads most about” is the patent abstract's nearest protein in MedCPT space (background-debiased). Only ~1.4% of patents have machine-readable text, so most compounds won't have this panel.