Styrene

Styrene

SCHEMBL3297409

C=C(C=C(C)C(=O)O)C(=O)OCC(CC)CCCC.C=Cc1ccccc1

nearest known ligand 0.48

Full drug profile on Sugi Atlas →

Predicted protein targets (top 20)

geneUniProtsupporting neighboursconfidence
ALDH1A1 P00352 6/20 0.48
CYP3A4 P08684 3/20 0.48
CA2 P00918 1/20 0.48
LMNA P02545 3/20 0.47
MAPK1 P28482 3/20 0.47
TSHR P16473 3/20 0.45
PRSS1 P07477 1/20 0.44
PRSS2 P07478 1/20 0.44
PRSS3 P35030 1/20 0.44
TDP1 Q9NUW8 2/20 0.41
HSD17B10 Q99714 1/20 0.39
ATM Q13315 1/20 0.39
KDM4E B2RXH2 2/20 0.35
RECQL P46063 1/20 0.34
MEN1 O00255 2/20 0.34
KMT2A Q03164 2/20 0.34
MAPT P10636 1/20 0.34
L3MBTL1 Q9Y468 1/20 0.34
AKR1C3 P42330 1/20 0.33
HDAC3 O15379 1/20 0.31

Click a target to see other patent compounds predicted against it — the reverse direction, in place.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL9169357 0.88 TSHR (0.54) ALDH1A1CYP3A4CA2LMNAMAPK1
Styrene SCHEMBL1246542 0.87 ALDH1A1 (0.54) ALDH1A1CYP3A4CA2LMNAMAPK1
Styrene SCHEMBL1981789 0.85 ALDH1A1 (0.50) ALDH1A1CYP3A4CA2LMNAMAPK1
Styrene SCHEMBL10579599 0.85 ALDH1A1 (0.52) ALDH1A1CYP3A4CA2LMNAMAPK1
Styrene SCHEMBL29158064 0.84 ALDH1A1 (0.49) ALDH1A1CYP3A4CA2LMNAMAPK1
SCHEMBL7760826 0.84 TDP1 (0.42) ALDH1A1CYP3A4CA2LMNAMAPK1
Styrene SCHEMBL251772 0.83 KDM4E (0.45) ALDH1A1CYP3A4LMNAMAPK1TSHR
Styrene SCHEMBL28988056 0.83 ALDH1A1 (0.50) ALDH1A1CYP3A4CA2LMNAMAPK1
SCHEMBL6576367 0.82 TSHR (0.48) ALDH1A1CYP3A4CA2LMNAMAPK1
Styrene SCHEMBL27467831 0.82 TSHR (0.64) ALDH1A1CYP3A4CA2LMNAMAPK1

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 13 patents. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-20060105263-A1 Toner composition XEROX CORPORATION 2006-05-18 US claimed
US-6605404-B2 Coated Carriers XEROX CORPORATION 2003-08-12 US claimed
US-20030064314-A1 Coated carriers XEROX CORPORATION 2003-04-03 US claimed
US-5928830-A Latex processes XEROX CORPORATION (US) 1999-07-27 US claimed
US-7731867-B2 Transition metal catalyst, an electroconductive material such as graphite; and a polymer binder blend of high molecular weight and low molecular weight acrylic (co)polymers, one having a higher glass transition temperature (Tg); catalytic inks for screen printing; use to make electrochemical sensors ANIMAS TECHNOLOGIES, LLC (US) 2010-06-08 US disclosed
US-20070170402-A1 Transition metal catalyst, an electroconductive material such as graphite; and a polymer binder blend of high molecular weight and low molecular weight acrylic (co)polymers, one having a higher glass transition temperature (Tg); catalytic inks for screen printing; use to make electrochemical sensors LIFESCAN IP HOLDINGS, LLC 2007-07-26 US disclosed
US-7189341-B2 Transition metal catalyst, an electroconductive material such as graphite; and a polymer binder blend of high molecular weight and low molecular weight acrylic (co)polymers, one having a higher glass transition temperature (Tg); catalytic inks for screen printing; use to make electrochemical sensors ANIMAS TECHNOLOGIES, LLC (US) 2007-03-13 US disclosed
US-20060105263-A1 Toner composition XEROX CORPORATION 2006-05-18 US disclosed
US-20050036020-A1 Electrochemical sensor ink compositions, electrodes, and uses thereof LIFESCAN IP HOLDINGS, LLC 2005-02-17 US disclosed
US-6605404-B2 Coated Carriers XEROX CORPORATION 2003-08-12 US disclosed
US-20030064314-A1 Coated carriers XEROX CORPORATION 2003-04-03 US disclosed
US-6503680-B1 Latex processes XEROX CORPORATION 2003-01-07 US disclosed
US-5928830-A Latex processes XEROX CORPORATION (US) 1999-07-27 US disclosed