SCHEMBL407233

SCHEMBL407233

O=C1C=C(O)C([C@@H](O)CF)O1

nearest known ligand 0.33

Predicted protein targets (top 3)

geneUniProtsupporting neighboursconfidence
MAPT P10636 1/20 0.33
LMNA P02545 1/20 0.33
L3MBTL1 Q9Y468 1/20 0.33

Click a target to see other patent compounds predicted against it — the reverse direction, in place.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL15976337 0.83 LMNA (0.50) MAPTLMNAL3MBTL1
SCHEMBL24037211 0.83 LMNA (0.50) MAPTLMNAL3MBTL1
SCHEMBL14089250 0.80 MAPT (0.33) MAPTLMNAL3MBTL1
SCHEMBL19140901 0.72 JUN (0.36)
SCHEMBL13842424 0.68 MAPT (0.70) MAPTLMNAL3MBTL1
SCHEMBL23803136 0.68 MAPT (0.70) MAPTLMNAL3MBTL1
SCHEMBL12559507 0.66 MAPT (0.47) MAPTLMNAL3MBTL1
SCHEMBL15827805 0.63 LMNA (0.49) MAPTLMNAL3MBTL1
SCHEMBL9285114 0.62
SCHEMBL1797707 0.61

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 7 patents. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-8349599-B2 Multimeric oxidoreductases DANISCO US INC. (US) 2013-01-08 US disclosed
US-20120064586-A1 Multimeric Oxidoreductases DANISCO US INC. 2012-03-15 US disclosed
US-8034593-B2 Multimeric oxidoreductases DANISCO US INC. (US) 2011-10-11 US disclosed
US-20110003353-A1 Multimeric Oxidoreductases DANISCO US INC. 2011-01-06 US disclosed
US-7803591-B2 Polynucleotide coding for a multimeric oxidoreductase complex having an alpha subunit, a gamma subunit and a cytochrome C subunit with specific amino acid sequences; used to manufacture of L-ascorbic acid GENENCOR INTERNATIONAL, INC. (US) 2010-09-28 US disclosed
US-20080293124-A1 Multimeric Oxidoreductases DANISCO US INC. 2008-11-27 US disclosed
US-7407780-B2 Process for producing glycerol in recombinant bacterial host cells GENENCOR INTERNATIONAL, INC. (US) 2008-08-05 US disclosed