Predicted protein targets (top 20)
| gene | UniProt | supporting neighbours | confidence | |
|---|---|---|---|---|
| ▸ | KDM4E | B2RXH2 | 3/20 | 0.90 |
| ▸ | HRH3 | Q9Y5N1 | 12/20 | 0.71 |
| ▸ | MAOB | P27338 | 2/20 | 0.67 |
| ▸ | HRH2 | P25021 | 2/20 | 0.67 |
| ▸ | HRH1 | P35367 | 2/20 | 0.67 |
| ▸ | POLB | P06746 | 1/20 | 0.67 |
| ▸ | MAPT | P10636 | 1/20 | 0.67 |
| ▸ | ALDH1A1 | P00352 | 2/20 | 0.66 |
| ▸ | KCNH2 | Q12809 | 2/20 | 0.65 |
| ▸ | PSMB1 | P20618 | 1/20 | 0.65 |
| ▸ | PSMB5 | P28074 | 1/20 | 0.65 |
| ▸ | PSMB2 | P49721 | 1/20 | 0.65 |
| ▸ | LMNA | P02545 | 1/20 | 0.64 |
| ▸ | CYP1A2 | P05177 | 1/20 | 0.64 |
| ▸ | CHRM2 | P08172 | 1/20 | 0.64 |
| ▸ | CHRM4 | P08173 | 1/20 | 0.64 |
| ▸ | CHRM5 | P08912 | 1/20 | 0.64 |
| ▸ | CYP2D6 | P10635 | 1/20 | 0.64 |
| ▸ | THRB | P10828 | 1/20 | 0.64 |
| ▸ | CYP2C9 | P11712 | 1/20 | 0.64 |
Click a target to see other patent compounds predicted against it — the reverse direction, in place.
Similar compounds — the chemically nearest patent molecules
Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.
| Compound | similarity | top predicted | shared targets | |
|---|---|---|---|---|
| SCHEMBL491803 | 0.99 | KDM4E (0.92) | KDM4EHRH3MAOBHRH2HRH1 | |
| SCHEMBL5213285 | 0.97 | KDM4E (0.89) | KDM4EHRH3MAOBHRH2HRH1 | |
| SCHEMBL6981478 | 0.97 | KDM4E (0.89) | KDM4EHRH3MAOBHRH2HRH1 | |
| SCHEMBL5856201 | 0.93 | KDM4E (0.78) | KDM4EHRH3MAOBALDH1A1THRB | |
| SCHEMBL490099 | 0.91 | KDM4E (0.80) | KDM4EHRH3MAOBALDH1A1THRB | |
| SCHEMBL12193816 | 0.91 | KDM4E (0.80) | KDM4EHRH3HRH2HRH1ALDH1A1 | |
| SCHEMBL6534752 | 0.90 | KDM4E (0.77) | KDM4EHRH3ALDH1A1PSMB1PSMB5 | |
| SCHEMBL7738349 | 0.87 | KDM4E (0.74) | KDM4EHRH3ALDH1A1KCNH2PSMB1 | |
| SCHEMBL5286039 | 0.87 | KDM4E (0.76) | KDM4EHRH3MAOBHRH2HRH1 | |
| SCHEMBL6052612 | 0.85 | KDM4E (0.71) | KDM4EHRH3MAOBALDH1A1THRB |
Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.
Patent provenance — the patents this molecule appears in, and who filed them
Claimed or disclosed in 1 patent. claimed = in the patent's claims; disclosed = body only.
| Patent | Title | Assignee | Published | Priority | Filing | Country | Status |
|---|---|---|---|---|---|---|---|
| US-7138413-B1 | Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders | SOCIETE CIVILE BIOPROJET (FR) | 2006-11-21 | — | — | US | disclosed |