SCHEMBL1345570

SCHEMBL1345570

FC(F)(F)c1cc(-c2nccn2Cc2ccccc2)[nH]n1

nearest known ligand 0.48

Predicted protein targets (top 20)

geneUniProtsupporting neighboursconfidence
HSD17B10 Q99714 1/20 0.47
BRD4 O60885 2/20 0.44
LIMK2 P53671 1/20 0.43
MEN1 O00255 4/20 0.40
KMT2A Q03164 4/20 0.40
HPGD P15428 1/20 0.40
ALDH1A1 P00352 3/20 0.39
HSP90AA1 P07900 1/20 0.39
OPRD1 P41143 1/20 0.39
CYP1A2 P05177 1/20 0.37
CYP3A4 P08684 1/20 0.37
CYP2D6 P10635 1/20 0.37
CYP2C9 P11712 1/20 0.37
ALOX12 P18054 1/20 0.37
CYP2C19 P33261 1/20 0.37
FDPS P14324 1/20 0.36
HSD11B1 P28845 1/20 0.36
TLR7 Q9NYK1 1/20 0.36
TNF P01375 1/20 0.35
CYP11B1 P15538 1/20 0.35

Click a target to see other patent compounds predicted against it — the reverse direction, in place.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL1346025 0.81 HSD17B10 (0.51) HSD17B10BRD4LIMK2MEN1KMT2A
SCHEMBL1346040 0.77 L3MBTL1 (0.40) CYP1A2CYP3A4CYP2D6CYP2C9CYP2C19
SCHEMBL18678753 0.76 KDM5B (0.42) MEN1KMT2AHPGDALDH1A1
SCHEMBL1346326 0.75 HSD17B10 (0.54) HSD17B10BRD4LIMK2MEN1KMT2A
SCHEMBL1528735 0.75 MAPT (0.49) HSD17B10BRD4LIMK2MEN1KMT2A
SCHEMBL1528539 0.73 CYP3A4 (0.57) HSD17B10BRD4LIMK2ALDH1A1CYP1A2
SCHEMBL18509261 0.73 LIMK2 (0.55) HSD17B10BRD4LIMK2MEN1KMT2A
SCHEMBL1343637 0.72 CCNC (0.34) HSD17B10BRD4
SCHEMBL17810214 0.71 HSD17B10 (0.48) HSD17B10MEN1KMT2AALDH1A1HSP90AA1
SCHEMBL17381008 0.71 HSD17B10 (0.49) HSD17B10BRD4LIMK2MEN1KMT2A

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 6 patents. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-8062767-B2 Organic light emitting diode containing a Ir complex having a novel ligand as a phosphorescent emitter Cheng, Chien-Hong (TW) 2011-11-22 US disclosed
US-8062767-B2 Organic light emitting diode containing a Ir complex having a novel ligand as a phosphorescent emitter Cheng, Chien-Hong (TW) 2011-11-22 US disclosed
US-8062767-B2 Organic light emitting diode containing a Ir complex having a novel ligand as a phosphorescent emitter Cheng, Chien-Hong (TW) 2011-11-22 US disclosed
US-20080217606-A1 Organic light emitting diode containing a Ir complex having a novel ligand as a phosphorescent emitter Cheng, Chien-Hong (TW) 2008-09-11 US disclosed
US-20080217606-A1 Organic light emitting diode containing a Ir complex having a novel ligand as a phosphorescent emitter Cheng, Chien-Hong (TW) 2008-09-11 US disclosed
US-20080217606-A1 Organic light emitting diode containing a Ir complex having a novel ligand as a phosphorescent emitter Cheng, Chien-Hong (TW) 2008-09-11 US disclosed