Predicted protein targets (top 18)
| gene | UniProt | supporting neighbours | confidence | |
|---|---|---|---|---|
| ▸ | CYP3A4 | P08684 | 3/20 | 0.41 |
| ▸ | TDP1 | Q9NUW8 | 1/20 | 0.41 |
| ▸ | KCNN4 | O15554 | 1/20 | 0.39 |
| ▸ | TP53 | P04637 | 1/20 | 0.38 |
| ▸ | ESR1 | P03372 | 4/20 | 0.34 |
| ▸ | ESR2 | Q92731 | 4/20 | 0.34 |
| ▸ | MTOR | P42345 | 1/20 | 0.32 |
| ▸ | RAB9A | P51151 | 1/20 | 0.32 |
| ▸ | GRM7 | Q14831 | 1/20 | 0.32 |
| ▸ | KDM4E | B2RXH2 | 1/20 | 0.32 |
| ▸ | MAPT | P10636 | 1/20 | 0.32 |
| ▸ | PSIP1 | O75475 | 1/20 | 0.32 |
| ▸ | TSHR | P16473 | 2/20 | 0.32 |
| ▸ | SIGMAR1 | Q99720 | 1/20 | 0.31 |
| ▸ | LMNA | P02545 | 1/20 | 0.31 |
| ▸ | ATM | Q13315 | 1/20 | 0.31 |
| ▸ | TAAR1 | Q96RJ0 | 1/20 | 0.31 |
| ▸ | ALOX15 | P16050 | 1/20 | 0.31 |
Click a target to see other patent compounds predicted against it — the reverse direction, in place.
Similar compounds — the chemically nearest patent molecules
Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.
| Compound | similarity | top predicted | shared targets | |
|---|---|---|---|---|
| SCHEMBL321882 | 0.89 | TDP1 (0.50) | CYP3A4TDP1ESR1ESR2MTOR | |
| SCHEMBL9288104 | 0.86 | TDP1 (0.47) | CYP3A4TDP1ESR1ESR2MTOR | |
| SCHEMBL2155415 | 0.79 | KCNN4 (0.44) | CYP3A4TDP1KCNN4TP53ESR1 | |
| SCHEMBL31606955 | 0.79 | CYP3A4 (0.41) | CYP3A4TDP1ESR1ESR2TSHR | |
| SCHEMBL17201445 | 0.78 | SIGMAR1 (0.38) | CYP3A4TDP1KCNN4TP53MTOR | |
| SCHEMBL4203004 | 0.76 | CYP3A4 (0.43) | CYP3A4TDP1KCNN4ESR1ESR2 | |
| SCHEMBL30359275 | 0.75 | ALDH1A1 (0.42) | KDM4EMAPTTSHRSIGMAR1 | |
| Propane SCHEMBL28233649 | 0.75 | CYP3A4 (0.75) | CYP3A4TDP1KCNN4TP53ESR1 | |
| Propane SCHEMBL27796760 | 0.75 | CYP3A4 (0.75) | CYP3A4TDP1KCNN4TP53ESR1 | |
| SCHEMBL14707690 | 0.74 | ALDH1A1 (0.47) | CYP3A4TDP1RAB9AMAPTTAAR1 |
Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.
Patent provenance — the patents this molecule appears in, and who filed them
Claimed or disclosed in 3 patents. claimed = in the patent's claims; disclosed = body only.
| Patent | Title | Assignee | Published | Priority | Filing | Country | Status |
|---|---|---|---|---|---|---|---|
| US-20110257352-A1 | Amino phosphine | NOVA Chemicals (International) S.A.. | 2011-10-20 | — | — | US | disclosed |
| US-7994363-B2 | Bis(bis(o-fluorophenyl)phosphino) isopropylamine; ethylene oligomerization catalyst; trimerization and tetramerization to 1-hexene and 1-octene also in the presence of a chromium source and a methalumoxane activator; further copolymerization, or separating 1-hexene by distillation; by-product inhibition | NOVA CHEMICALS (INTERNATIONAL) S.A (CH) | 2011-08-09 | — | — | US | disclosed |
| US-20080242811-A1 | Amino phosphine | NOVA CHEMICALS(INTERNATIONAL) S.A. | 2008-10-02 | — | — | US | disclosed |
Patent text — is the patent's own abstract consistent with the prediction?
For each of this compound's patents that has machine-readable text (1 of them — usually the abstract, not the full specification), we ask MedCPT which protein the text reads most about, and where the chemistry-predicted target lands among 4885 human targets. A high rank means the patent's own wording is consistent with the prediction — a weak, independent signal, not proof of activity.
| Patent | Title | Text reads most about | Predicted target · text-rank |
|---|---|---|---|
| US-20080242811-A1 | Amino phosphine | PAM, POF1B, PHOSPHO1 | CYP3A4 3596/4885TDP1 1715/4885KCNN4 299/4885 |
“Text reads most about” is the patent abstract's nearest protein in MedCPT space (background-debiased). Only ~1.4% of patents have machine-readable text, so most compounds won't have this panel.