Predicted protein targets (top 7)
| gene | UniProt | supporting neighbours | confidence | |
|---|---|---|---|---|
| ▸ | HRH3 | Q9Y5N1 | 14/20 | 0.71 |
| ▸ | KDM4E | B2RXH2 | 1/20 | 0.60 |
| ▸ | ALDH1A1 | P00352 | 1/20 | 0.60 |
| ▸ | TSHR | P16473 | 1/20 | 0.60 |
| ▸ | HRH1 | P35367 | 2/20 | 0.58 |
| ▸ | HRH2 | P25021 | 1/20 | 0.58 |
| ▸ | CCR3 | P51677 | 1/20 | 0.55 |
Click a target to see other patent compounds predicted against it — the reverse direction, in place.
Similar compounds — the chemically nearest patent molecules
Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.
| Compound | similarity | top predicted | shared targets | |
|---|---|---|---|---|
| SCHEMBL491737 | 0.99 | HRH3 (0.72) | HRH3KDM4EALDH1A1TSHRHRH1 | |
| SCHEMBL30357733 | 0.89 | LTA4H (0.61) | HRH3KDM4EALDH1A1HRH1HRH2 | |
| SCHEMBL5856461 | 0.85 | HRH3 (0.97) | HRH3HRH1HRH2 | |
| SCHEMBL5856359 | 0.83 | HRH3 (0.94) | HRH3HRH1HRH2 | |
| SCHEMBL491835 | 0.83 | HRH3 (1.00) | HRH3HRH1HRH2 | |
| SCHEMBL7388461 | 0.83 | TBXAS1 (0.56) | HRH1CCR3 | |
| SCHEMBL491659 | 0.82 | HRH3 (0.97) | HRH3HRH1HRH2 | |
| SCHEMBL8796178 | 0.82 | HRH3 (0.68) | HRH3KDM4EALDH1A1TSHRHRH1 | |
| SCHEMBL5288608 | 0.81 | HRH3 (0.79) | HRH3HRH1HRH2 | |
| SCHEMBL492176 | 0.80 | HRH3 (0.79) | HRH3KDM4EALDH1A1 |
Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.
Patent provenance — the patents this molecule appears in, and who filed them
Claimed or disclosed in 1 patent. claimed = in the patent's claims; disclosed = body only.
| Patent | Title | Assignee | Published | Priority | Filing | Country | Status |
|---|---|---|---|---|---|---|---|
| US-7138413-B1 | Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders | SOCIETE CIVILE BIOPROJET (FR) | 2006-11-21 | — | — | US | disclosed |