SCHEMBL391960

SCHEMBL391960

CC(=O)NCCC(NC(=O)O)c1ccc(Cl)cc1

nearest known ligand 0.50

Predicted protein targets (top 5)

geneUniProtsupporting neighboursconfidence
MTNR1A P48039 1/20 0.50
MTNR1B P49286 1/20 0.50
UTS2R Q9UKP6 14/20 0.47
CNR1 P21554 2/20 0.47
AKT1 P31749 1/20 0.46

Click a target to see other patent compounds predicted against it — the reverse direction, in place.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL3656739 0.88 UTS2R (0.47) MTNR1AMTNR1BUTS2RCNR1
SCHEMBL20544753 0.85 THRB (0.48) UTS2RCNR1AKT1
SCHEMBL20544787 0.85 UTS2R (0.49) UTS2R
SCHEMBL20544515 0.85 ROCK2 (0.44) MTNR1AMTNR1BUTS2RCNR1AKT1
SCHEMBL20544752 0.81 UTS2R (0.48) UTS2R
SCHEMBL390470 0.81 P2RY2 (0.46) MTNR1AMTNR1BUTS2RCNR1AKT1
SCHEMBL20544740 0.80 ROCK2 (0.47) UTS2RAKT1
SCHEMBL20544982 0.80 WDR91 (0.49) UTS2R
SCHEMBL20544940 0.78 UTS2R (0.51) UTS2R
SCHEMBL20544776 0.78 UTS2R (0.73) UTS2R

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 14 patents. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-20240109902-A1 PROTEIN KINASE B INHIBITORS ASTRAZENECA AB (SE) 2024-04-04 US disclosed
US-11760760-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2023-09-19 US disclosed
US-20220220116-A1 PROTEIN KINASE B INHIBITORS ASTRAZENECA AB (SE) 2022-07-14 US disclosed
US-11236095-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2022-02-01 US disclosed
US-20200239483-A1 PROTEIN KINASE B INHIBITORS ASTRAZENECA AB (SE) 2020-07-30 US disclosed
US-10654855-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2020-05-19 US disclosed
US-20180312516-A1 Protein Kinase B Inhibitors ASTRAZENECA AB (SE) 2018-11-01 US disclosed
US-10059714-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2018-08-28 US disclosed
US-20170057969-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2017-03-02 US disclosed
US-9492453-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2016-11-15 US disclosed
US-20150182531-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2015-07-02 US disclosed
US-20120190679-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2012-07-26 US disclosed
US-8101623-B2 Substituted pyrrolo[2,3-d]pyrimidine as a protein kinase B inhibitor ASTRAZENECA AB (SE) 2012-01-24 US disclosed
US-20090163524-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2009-06-25 US disclosed

Patent text — is the patent's own abstract consistent with the prediction?

For each of this compound's patents that has machine-readable text (12 of them — usually the abstract, not the full specification), we ask MedCPT which protein the text reads most about, and where the chemistry-predicted target lands among 4885 human targets. A high rank means the patent's own wording is consistent with the prediction — a weak, independent signal, not proof of activity.

PatentTitleText reads most aboutPredicted target · text-rank
US-20220220116-A1 PROTEIN KINASE B INHIBITORS PRKAR2B, PRKCB, AKT1 MTNR1A 2147/4885MTNR1B 988/4885UTS2R 3101/4885
US-20180312516-A1 Protein Kinase B Inhibitors PRKAR2B, PRKCB, AKT1 MTNR1A 2147/4885MTNR1B 988/4885UTS2R 3101/4885
US-10654855-B2 Protein kinase B inhibitors PRKAR2B, PRKCB, AKT1 MTNR1A 2147/4885MTNR1B 988/4885UTS2R 3101/4885
US-20240109902-A1 PROTEIN KINASE B INHIBITORS PRKAR2B, PRKCB, AKT1 MTNR1A 2147/4885MTNR1B 988/4885UTS2R 3101/4885
US-10059714-B2 Protein kinase B inhibitors PRKAR2B, PRKCB, AKT1 MTNR1A 2147/4885MTNR1B 988/4885UTS2R 3101/4885
US-20090163524-A1 Novel Protein Kinase B Inhibitors - 060 PRKAR2B, PRKCB, MAP3K20 MTNR1A 2374/4885MTNR1B 1203/4885UTS2R 2892/4885
US-20170057969-A1 Novel Protein Kinase B Inhibitors - 060 PRKAR2B, PRKCB, MAP3K20 MTNR1A 2374/4885MTNR1B 1203/4885UTS2R 2892/4885
US-20200239483-A1 PROTEIN KINASE B INHIBITORS PRKAR2B, PRKCB, AKT1 MTNR1A 2147/4885MTNR1B 988/4885UTS2R 3101/4885
US-20120190679-A1 Novel Protein Kinase B Inhibitors - 060 PRKAR2B, PRKCB, MAP3K20 MTNR1A 2374/4885MTNR1B 1203/4885UTS2R 2892/4885
US-11236095-B2 Protein kinase B inhibitors PRKAR2B, PRKCB, AKT1 MTNR1A 2147/4885MTNR1B 988/4885UTS2R 3101/4885
US-20150182531-A1 Novel Protein Kinase B Inhibitors - 060 PRKAR2B, PRKCB, MAP3K20 MTNR1A 2374/4885MTNR1B 1203/4885UTS2R 2892/4885
US-11760760-B2 Protein kinase B inhibitors PRKAR2B, PRKCB, AKT1 MTNR1A 2147/4885MTNR1B 988/4885UTS2R 3101/4885

“Text reads most about” is the patent abstract's nearest protein in MedCPT space (background-debiased). Only ~1.4% of patents have machine-readable text, so most compounds won't have this panel.